C32H28N4O2 — CID 135296259
1-[(10S,14R,15R)-4-(6-methoxy-2-phenyl-3-pyridinyl)-15-phenyl-1,8,12-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraen-12-yl]ethanone (PubChem CID 135296259) has the molecular formula C32H28N4O2 and a molecular weight of 500.60 g/mol. Its IUPAC name is 1-[(10S,14R,15R)-4-(6-methoxy-2-phenyl-3-pyridinyl)-15-phenyl-1,8,12-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraen-12-yl]ethanone.
| Compound Name | 1-[(10S,14R,15R)-4-(6-methoxy-2-phenyl-3-pyridinyl)-15-phenyl-1,8,12-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraen-12-yl]ethanone |
|---|---|
| PubChem CID | 135296259 |
| Molecular Formula | C32H28N4O2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 1-[(10S,14R,15R)-4-(6-methoxy-2-phenyl-3-pyridinyl)-15-phenyl-1,8,12-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraen-12-yl]ethanone |
| SMILES | COc1ccc(-c2ccc3nc4n(c3c2)[C@@H](c2ccccc2)[C@H]2CN(C(C)=O)C[C@@H]42)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C32H28N4O2/c1-20(37)35-18-25-26(19-35)32-33-27-15-13-23(17-28(27)36(32)31(25)22-11-7-4-8-12-22)24-14-16-29(38-2)34-30(24)21-9-5-3-6-10-21/h3-17,25-26,31H,18-19H2,1-2H3/t25-,26+,31-/m0/s1 |
| InChIKey | DRDBBHMTICZPRZ-HEHLMWRFSA-N |
| XLogP | 5.94 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |