C27H34ClN5O3 — CID 135292243
tert-butyl 4-[3-(aziridin-2-yl)-5-[(2-chloro-4-pyridinyl)oxy]-6-cyclopropyl-2-pyridinyl]-2-cyclopropylpiperazine-1-carboxylate (PubChem CID 135292243) has the molecular formula C27H34ClN5O3 and a molecular weight of 512.05 g/mol. Its IUPAC name is tert-butyl 4-[3-(aziridin-2-yl)-5-[(2-chloro-4-pyridinyl)oxy]-6-cyclopropyl-2-pyridinyl]-2-cyclopropylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(aziridin-2-yl)-5-[(2-chloro-4-pyridinyl)oxy]-6-cyclopropyl-2-pyridinyl]-2-cyclopropylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 135292243 |
| Molecular Formula | C27H34ClN5O3 |
| Molecular Weight | 512.05 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | tert-butyl 4-[3-(aziridin-2-yl)-5-[(2-chloro-4-pyridinyl)oxy]-6-cyclopropyl-2-pyridinyl]-2-cyclopropylpiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2nc(C3CC3)c(Oc3ccnc(Cl)c3)cc2C2CN2)CC1C1CC1 |
| InChI | InChI=1S/C27H34ClN5O3/c1-27(2,3)36-26(34)33-11-10-32(15-21(33)16-4-5-16)25-19(20-14-30-20)13-22(24(31-25)17-6-7-17)35-18-8-9-29-23(28)12-18/h8-9,12-13,16-17,20-21,30H,4-7,10-11,14-15H2,1-3H3 |
| InChIKey | SVTJCBIGLYFECQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 89.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.05 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|