C25H37N — CID 135294807
(2E,5Z,8E)-8-(4-butylcyclohexa-1,5-dien-1-yl)-6-methyl-4-methylidene-3-prop-1-en-2-yldeca-2,5,8-trien-2-amine (PubChem CID 135294807) has the molecular formula C25H37N and a molecular weight of 351.58 g/mol. Its IUPAC name is (2E,5Z,8E)-8-(4-butylcyclohexa-1,5-dien-1-yl)-6-methyl-4-methylidene-3-prop-1-en-2-yldeca-2,5,8-trien-2-amine.
| Compound Name | (2E,5Z,8E)-8-(4-butylcyclohexa-1,5-dien-1-yl)-6-methyl-4-methylidene-3-prop-1-en-2-yldeca-2,5,8-trien-2-amine |
|---|---|
| PubChem CID | 135294807 |
| Molecular Formula | C25H37N |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | (2E,5Z,8E)-8-(4-butylcyclohexa-1,5-dien-1-yl)-6-methyl-4-methylidene-3-prop-1-en-2-yldeca-2,5,8-trien-2-amine |
| SMILES | C=C(C)/C(C(=C)/C=C(/C)C/C(=C\C)C1=CCC(CCCC)C=C1)=C(/C)N |
| InChI | InChI=1S/C25H37N/c1-8-10-11-22-12-14-24(15-13-22)23(9-2)17-19(5)16-20(6)25(18(3)4)21(7)26/h9,12,14-16,22H,3,6,8,10-11,13,17,26H2,1-2,4-5,7H3/b19-16-,23-9+,25-21+ |
| InChIKey | IEYZSCLBVSNTFE-CMJQCOKESA-N |
| XLogP | 7.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|