C11H22N2OS — CID 135295396
(2Z,4Z)-N-(dimethylaminosulfanyl)-2-methoxy-5-methylhepta-2,4-dien-3-amine (PubChem CID 135295396) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is (2Z,4Z)-N-(dimethylaminosulfanyl)-2-methoxy-5-methylhepta-2,4-dien-3-amine.
| Compound Name | (2Z,4Z)-N-(dimethylaminosulfanyl)-2-methoxy-5-methylhepta-2,4-dien-3-amine |
|---|---|
| PubChem CID | 135295396 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (2Z,4Z)-N-(dimethylaminosulfanyl)-2-methoxy-5-methylhepta-2,4-dien-3-amine |
| SMILES | CC/C(C)=C\C(NSN(C)C)=C(/C)OC |
| InChI | InChI=1S/C11H22N2OS/c1-7-9(2)8-11(10(3)14-6)12-15-13(4)5/h8,12H,7H2,1-6H3/b9-8-,11-10- |
| InChIKey | HYLTWUCNTUWOMZ-XESWYYRISA-N |
| XLogP | 2.93 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|