C9H17NO2S — CID 145337558
N-[(2Z,4Z)-2-hydroxy-5-methylhepta-2,4-dien-3-yl]methanesulfinamide (PubChem CID 145337558) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is N-[(2Z,4Z)-2-hydroxy-5-methylhepta-2,4-dien-3-yl]methanesulfinamide.
| Compound Name | N-[(2Z,4Z)-2-hydroxy-5-methylhepta-2,4-dien-3-yl]methanesulfinamide |
|---|---|
| PubChem CID | 145337558 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | N-[(2Z,4Z)-2-hydroxy-5-methylhepta-2,4-dien-3-yl]methanesulfinamide |
| SMILES | CC/C(C)=C\C(NS(C)=O)=C(/C)O |
| InChI | InChI=1S/C9H17NO2S/c1-5-7(2)6-9(8(3)11)10-13(4)12/h6,10-11H,5H2,1-4H3/b7-6-,9-8- |
| InChIKey | AYNUZNCUPUXNCE-JPDBVBESSA-N |
| XLogP | 2.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|