C40H62N4O4 — CID 135296267
(E)-N-butyl-N-cyclohexyl-10-[methyl-[(2Z,4Z)-6-[prop-2-enoyl-[(E)-4-[prop-2-enoyl(prop-2-enyl)amino]but-2-enyl]amino]hexa-2,4-dienoyl]amino]dec-2-enamide (PubChem CID 135296267) has the molecular formula C40H62N4O4 and a molecular weight of 662.96 g/mol. Its IUPAC name is (E)-N-butyl-N-cyclohexyl-10-[methyl-[(2Z,4Z)-6-[prop-2-enoyl-[(E)-4-[prop-2-enoyl(prop-2-enyl)amino]but-2-enyl]amino]hexa-2,4-dienoyl]amino]dec-2-enamide.
| Compound Name | (E)-N-butyl-N-cyclohexyl-10-[methyl-[(2Z,4Z)-6-[prop-2-enoyl-[(E)-4-[prop-2-enoyl(prop-2-enyl)amino]but-2-enyl]amino]hexa-2,4-dienoyl]amino]dec-2-enamide |
|---|---|
| PubChem CID | 135296267 |
| Molecular Formula | C40H62N4O4 |
| Molecular Weight | 662.96 g/mol |
| Exact Mass | 662.48 |
| IUPAC Name | (E)-N-butyl-N-cyclohexyl-10-[methyl-[(2Z,4Z)-6-[prop-2-enoyl-[(E)-4-[prop-2-enoyl(prop-2-enyl)amino]but-2-enyl]amino]hexa-2,4-dienoyl]amino]dec-2-enamide |
| SMILES | C=CCN(C/C=C/CN(C/C=C\C=C/C(=O)N(C)CCCCCCC/C=C/C(=O)N(CCCC)C1CCCCC1)C(=O)C=C)C(=O)C=C |
| InChI | InChI=1S/C40H62N4O4/c1-6-10-35-44(36-26-18-16-19-27-36)40(48)29-20-14-12-11-13-15-22-31-41(5)39(47)28-21-17-23-32-43(38(46)9-4)34-25-24-33-42(30-7-2)37(45)8-3/h7-9,17,20-21,23-25,28-29,36H,2-4,6,10-16,18-19,22,26-27,30-35H2,1,5H3/b23-17-,25-24+,28-21-,29-20+ |
| InChIKey | AALVBPVQWFZUJL-BBHLNVJXSA-N |
| XLogP | 7.19 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.96 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|