C39H60N4O4 — CID 155201473
(E)-N-butyl-N-cyclohexyl-9-[methyl-[(2Z,4Z)-6-[prop-2-enoyl-[(E)-4-[prop-2-enoyl(prop-2-enyl)amino]but-2-enyl]amino]hexa-2,4-dienoyl]amino]non-2-enamide (PubChem CID 155201473) has the molecular formula C39H60N4O4 and a molecular weight of 648.93 g/mol. Its IUPAC name is (E)-N-butyl-N-cyclohexyl-9-[methyl-[(2Z,4Z)-6-[prop-2-enoyl-[(E)-4-[prop-2-enoyl(prop-2-enyl)amino]but-2-enyl]amino]hexa-2,4-dienoyl]amino]non-2-enamide.
| Compound Name | (E)-N-butyl-N-cyclohexyl-9-[methyl-[(2Z,4Z)-6-[prop-2-enoyl-[(E)-4-[prop-2-enoyl(prop-2-enyl)amino]but-2-enyl]amino]hexa-2,4-dienoyl]amino]non-2-enamide |
|---|---|
| PubChem CID | 155201473 |
| Molecular Formula | C39H60N4O4 |
| Molecular Weight | 648.93 g/mol |
| Exact Mass | 648.46 |
| IUPAC Name | (E)-N-butyl-N-cyclohexyl-9-[methyl-[(2Z,4Z)-6-[prop-2-enoyl-[(E)-4-[prop-2-enoyl(prop-2-enyl)amino]but-2-enyl]amino]hexa-2,4-dienoyl]amino]non-2-enamide |
| SMILES | C=CCN(C/C=C/CN(C/C=C\C=C/C(=O)N(C)CCCCCC/C=C/C(=O)N(CCCC)C1CCCCC1)C(=O)C=C)C(=O)C=C |
| InChI | InChI=1S/C39H60N4O4/c1-6-10-34-43(35-25-17-15-18-26-35)39(47)28-19-13-11-12-14-21-30-40(5)38(46)27-20-16-22-31-42(37(45)9-4)33-24-23-32-41(29-7-2)36(44)8-3/h7-9,16,19-20,22-24,27-28,35H,2-4,6,10-15,17-18,21,25-26,29-34H2,1,5H3/b22-16-,24-23+,27-20-,28-19+ |
| InChIKey | CVOCHVATYUNAGJ-UCJYQMTPSA-N |
| XLogP | 6.80 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.93 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|