C24H29ClN2O6 — CID 135296977
10-chloro-6-(2-methylbutan-2-yl)-9-[3-(oxetan-3-yloxy)propoxy]-2-oxo-7H-pyrido[2,1-a]phthalazine-3-carboxylic acid (PubChem CID 135296977) has the molecular formula C24H29ClN2O6 and a molecular weight of 476.96 g/mol. Its IUPAC name is 10-chloro-6-(2-methylbutan-2-yl)-9-[3-(oxetan-3-yloxy)propoxy]-2-oxo-7H-pyrido[2,1-a]phthalazine-3-carboxylic acid.
| Compound Name | 10-chloro-6-(2-methylbutan-2-yl)-9-[3-(oxetan-3-yloxy)propoxy]-2-oxo-7H-pyrido[2,1-a]phthalazine-3-carboxylic acid |
|---|---|
| PubChem CID | 135296977 |
| Molecular Formula | C24H29ClN2O6 |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 10-chloro-6-(2-methylbutan-2-yl)-9-[3-(oxetan-3-yloxy)propoxy]-2-oxo-7H-pyrido[2,1-a]phthalazine-3-carboxylic acid |
| SMILES | CCC(C)(C)N1Cc2cc(OCCCOC3COC3)c(Cl)cc2-c2cc(=O)c(C(=O)O)cn21 |
| InChI | InChI=1S/C24H29ClN2O6/c1-4-24(2,3)27-11-15-8-22(33-7-5-6-32-16-13-31-14-16)19(25)9-17(15)20-10-21(28)18(23(29)30)12-26(20)27/h8-10,12,16H,4-7,11,13-14H2,1-3H3,(H,29,30) |
| InChIKey | HNRXDKZJAQKTLE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|