C26H36N2O6 — CID 135296934
ethyl 10-ethoxy-9-(3-methoxypropoxy)-6-(2-methylbutan-2-yl)-2-oxo-7H-pyrido[2,1-a]phthalazine-3-carboxylate (PubChem CID 135296934) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is ethyl 10-ethoxy-9-(3-methoxypropoxy)-6-(2-methylbutan-2-yl)-2-oxo-7H-pyrido[2,1-a]phthalazine-3-carboxylate.
| Compound Name | ethyl 10-ethoxy-9-(3-methoxypropoxy)-6-(2-methylbutan-2-yl)-2-oxo-7H-pyrido[2,1-a]phthalazine-3-carboxylate |
|---|---|
| PubChem CID | 135296934 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | ethyl 10-ethoxy-9-(3-methoxypropoxy)-6-(2-methylbutan-2-yl)-2-oxo-7H-pyrido[2,1-a]phthalazine-3-carboxylate |
| SMILES | CCOC(=O)c1cn2c(cc1=O)-c1cc(OCC)c(OCCCOC)cc1CN2C(C)(C)CC |
| InChI | InChI=1S/C26H36N2O6/c1-7-26(4,5)28-16-18-13-23(34-12-10-11-31-6)24(32-8-2)14-19(18)21-15-22(29)20(17-27(21)28)25(30)33-9-3/h13-15,17H,7-12,16H2,1-6H3 |
| InChIKey | QDTQGXXSYBYJJN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 79.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|