C22H28N2O5 — CID 134223945
6-tert-butyl-9-(3-methoxypropoxy)-10-methyl-2-oxo-7H-pyrido[2,1-a]phthalazine-3-carboxylic acid (PubChem CID 134223945) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is 6-tert-butyl-9-(3-methoxypropoxy)-10-methyl-2-oxo-7H-pyrido[2,1-a]phthalazine-3-carboxylic acid.
| Compound Name | 6-tert-butyl-9-(3-methoxypropoxy)-10-methyl-2-oxo-7H-pyrido[2,1-a]phthalazine-3-carboxylic acid |
|---|---|
| PubChem CID | 134223945 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 6-tert-butyl-9-(3-methoxypropoxy)-10-methyl-2-oxo-7H-pyrido[2,1-a]phthalazine-3-carboxylic acid |
| SMILES | COCCCOc1cc2c(cc1C)-c1cc(=O)c(C(=O)O)cn1N(C(C)(C)C)C2 |
| InChI | InChI=1S/C22H28N2O5/c1-14-9-16-15(10-20(14)29-8-6-7-28-5)12-24(22(2,3)4)23-13-17(21(26)27)19(25)11-18(16)23/h9-11,13H,6-8,12H2,1-5H3,(H,26,27) |
| InChIKey | VNHUXFGIRMCOMN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|