C25H36N2O6 — CID 142409234
ethane;ethyl 6-tert-butyl-10-hydroxy-9-(3-methoxypropoxy)-2-oxo-7H-pyrido[2,1-a]phthalazine-3-carboxylate (PubChem CID 142409234) has the molecular formula C25H36N2O6 and a molecular weight of 460.57 g/mol. Its IUPAC name is ethane;ethyl 6-tert-butyl-10-hydroxy-9-(3-methoxypropoxy)-2-oxo-7H-pyrido[2,1-a]phthalazine-3-carboxylate.
| Compound Name | ethane;ethyl 6-tert-butyl-10-hydroxy-9-(3-methoxypropoxy)-2-oxo-7H-pyrido[2,1-a]phthalazine-3-carboxylate |
|---|---|
| PubChem CID | 142409234 |
| Molecular Formula | C25H36N2O6 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | ethane;ethyl 6-tert-butyl-10-hydroxy-9-(3-methoxypropoxy)-2-oxo-7H-pyrido[2,1-a]phthalazine-3-carboxylate |
| SMILES | CC.CCOC(=O)c1cn2c(cc1=O)-c1cc(O)c(OCCCOC)cc1CN2C(C)(C)C |
| InChI | InChI=1S/C23H30N2O6.C2H6/c1-6-30-22(28)17-14-24-18(12-19(17)26)16-11-20(27)21(31-9-7-8-29-5)10-15(16)13-25(24)23(2,3)4;1-2/h10-12,14,27H,6-9,13H2,1-5H3;1-2H3 |
| InChIKey | OAUAAQCLUMXHKO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|