C22H22F6N2O7S — CID 142409226
ethyl 6-(2-methylbutan-2-yl)-2-oxo-10-(trifluoromethoxy)-9-(trifluoromethylsulfonyloxy)-7H-pyrido[2,1-a]phthalazine-3-carboxylate (PubChem CID 142409226) has the molecular formula C22H22F6N2O7S and a molecular weight of 572.48 g/mol. Its IUPAC name is ethyl 6-(2-methylbutan-2-yl)-2-oxo-10-(trifluoromethoxy)-9-(trifluoromethylsulfonyloxy)-7H-pyrido[2,1-a]phthalazine-3-carboxylate.
| Compound Name | ethyl 6-(2-methylbutan-2-yl)-2-oxo-10-(trifluoromethoxy)-9-(trifluoromethylsulfonyloxy)-7H-pyrido[2,1-a]phthalazine-3-carboxylate |
|---|---|
| PubChem CID | 142409226 |
| Molecular Formula | C22H22F6N2O7S |
| Molecular Weight | 572.48 g/mol |
| Exact Mass | 572.11 |
| IUPAC Name | ethyl 6-(2-methylbutan-2-yl)-2-oxo-10-(trifluoromethoxy)-9-(trifluoromethylsulfonyloxy)-7H-pyrido[2,1-a]phthalazine-3-carboxylate |
| SMILES | CCOC(=O)c1cn2c(cc1=O)-c1cc(OC(F)(F)F)c(OS(=O)(=O)C(F)(F)F)cc1CN2C(C)(C)CC |
| InChI | InChI=1S/C22H22F6N2O7S/c1-5-20(3,4)30-10-12-7-18(37-38(33,34)22(26,27)28)17(36-21(23,24)25)8-13(12)15-9-16(31)14(11-29(15)30)19(32)35-6-2/h7-9,11H,5-6,10H2,1-4H3 |
| InChIKey | VIHZZGQMBHAJJL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 104.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|