C15H32N2O4 — CID 135297171
tert-butyl [(1R,2S,3S)-1-methoxy-3-methyl-2-[methyl(methylaminomethyl)amino]pentyl] carbonate (PubChem CID 135297171) has the molecular formula C15H32N2O4 and a molecular weight of 304.43 g/mol. Its IUPAC name is tert-butyl [(1R,2S,3S)-1-methoxy-3-methyl-2-[methyl(methylaminomethyl)amino]pentyl] carbonate.
| Compound Name | tert-butyl [(1R,2S,3S)-1-methoxy-3-methyl-2-[methyl(methylaminomethyl)amino]pentyl] carbonate |
|---|---|
| PubChem CID | 135297171 |
| Molecular Formula | C15H32N2O4 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | tert-butyl [(1R,2S,3S)-1-methoxy-3-methyl-2-[methyl(methylaminomethyl)amino]pentyl] carbonate |
| SMILES | CC[C@H](C)[C@@H]([C@H](OC)OC(=O)OC(C)(C)C)N(C)CNC |
| InChI | InChI=1S/C15H32N2O4/c1-9-11(2)12(17(7)10-16-6)13(19-8)20-14(18)21-15(3,4)5/h11-13,16H,9-10H2,1-8H3/t11-,12-,13+/m0/s1 |
| InChIKey | MXLMGRWQGOUXPE-RWMBFGLXSA-N |
| XLogP | 2.43 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|