About [1-(2,2-dimethylpropanoyl)cyclopropyl] azetidine-1-carboxylate
[1-(2,2-dimethylpropanoyl)cyclopropyl] azetidine-1-carboxylate (PubChem CID 135298429) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is [1-(2,2-dimethylpropanoyl)cyclopropyl] azetidine-1-carboxylate.
Analyze [1-(2,2-dimethylpropanoyl)cyclopropyl] azetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2-dimethylpropanoyl)cyclopropyl] azetidine-1-carboxylate?
The IUPAC name of [1-(2,2-dimethylpropanoyl)cyclopropyl] azetidine-1-carboxylate (CID 135298429) is [1-(2,2-dimethylpropanoyl)cyclopropyl] azetidine-1-carboxylate.
What is the SMILES notation for [1-(2,2-dimethylpropanoyl)cyclopropyl] azetidine-1-carboxylate?
The canonical SMILES for [1-(2,2-dimethylpropanoyl)cyclopropyl] azetidine-1-carboxylate is CC(C)(C)C(=O)C1(OC(=O)N2CCC2)CC1.
What is the InChIKey of [1-(2,2-dimethylpropanoyl)cyclopropyl] azetidine-1-carboxylate?
The InChIKey is HCNCGEVVTWHDEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO3/c1-11(2,3)9(14)12(5-6-12)16-10(15)13-7-4-8-13/h4-8H2,1-3H3.
What are the key properties of [1-(2,2-dimethylpropanoyl)cyclopropyl] azetidine-1-carboxylate?
[1-(2,2-dimethylpropanoyl)cyclopropyl] azetidine-1-carboxylate has a molecular weight of 225.29 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2-dimethylpropanoyl)cyclopropyl] azetidine-1-carboxylate is sourced from PubChem (CID 135298429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).