C11H14F2INO3 — CID 134570697
(1-carboniodidoyl-4,4-difluorocyclohexyl) azetidine-1-carboxylate (PubChem CID 134570697) has the molecular formula C11H14F2INO3 and a molecular weight of 373.14 g/mol. Its IUPAC name is (1-carboniodidoyl-4,4-difluorocyclohexyl) azetidine-1-carboxylate.
| Compound Name | (1-carboniodidoyl-4,4-difluorocyclohexyl) azetidine-1-carboxylate |
|---|---|
| PubChem CID | 134570697 |
| Molecular Formula | C11H14F2INO3 |
| Molecular Weight | 373.14 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | (1-carboniodidoyl-4,4-difluorocyclohexyl) azetidine-1-carboxylate |
| SMILES | O=C(OC1(C(=O)I)CCC(F)(F)CC1)N1CCC1 |
| InChI | InChI=1S/C11H14F2INO3/c12-11(13)4-2-10(3-5-11,8(14)16)18-9(17)15-6-1-7-15/h1-7H2 |
| InChIKey | YIRNWDNKVGYRSB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.14 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|