About fluoro 4-(3,3-difluoropiperidin-1-yl)piperidine-1-carboxylate
fluoro 4-(3,3-difluoropiperidin-1-yl)piperidine-1-carboxylate (PubChem CID 177326834) has the molecular formula C11H17F3N2O2
and a molecular weight of 266.26 g/mol. Its IUPAC name is fluoro 4-(3,3-difluoropiperidin-1-yl)piperidine-1-carboxylate.
Analyze fluoro 4-(3,3-difluoropiperidin-1-yl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro 4-(3,3-difluoropiperidin-1-yl)piperidine-1-carboxylate?
The IUPAC name of fluoro 4-(3,3-difluoropiperidin-1-yl)piperidine-1-carboxylate (CID 177326834) is fluoro 4-(3,3-difluoropiperidin-1-yl)piperidine-1-carboxylate.
What is the SMILES notation for fluoro 4-(3,3-difluoropiperidin-1-yl)piperidine-1-carboxylate?
The canonical SMILES for fluoro 4-(3,3-difluoropiperidin-1-yl)piperidine-1-carboxylate is O=C(OF)N1CCC(N2CCCC(F)(F)C2)CC1.
What is the InChIKey of fluoro 4-(3,3-difluoropiperidin-1-yl)piperidine-1-carboxylate?
The InChIKey is ZPWDTQCHVJGACU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3N2O2/c12-11(13)4-1-5-16(8-11)9-2-6-15(7-3-9)10(17)18-14/h9H,1-8H2.
What are the key properties of fluoro 4-(3,3-difluoropiperidin-1-yl)piperidine-1-carboxylate?
fluoro 4-(3,3-difluoropiperidin-1-yl)piperidine-1-carboxylate has a molecular weight of 266.26 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 4-(3,3-difluoropiperidin-1-yl)piperidine-1-carboxylate is sourced from PubChem (CID 177326834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).