3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylic acid

C8H12F2N2O2 — CID 141284358

IUPAC3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylic acid
SMILESO=C(O)N1CC(N2CCC(F)(F)C2)C1
InChIInChI=1S/C8H12F2N2O2/c9-8(10)1-2-11(5-8)6-3-12(4-6)7(13)14/h6H,1-5H2,(H,13,14)
InChIKeyLFJMHABUODYCLT-UHFFFAOYSA-N
MW206.19 g/mol
LogP0.69
Rot. Bonds1

About 3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylic acid

3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylic acid (PubChem CID 141284358) has the molecular formula C8H12F2N2O2 and a molecular weight of 206.19 g/mol. Its IUPAC name is 3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylic acid.

Molecular Properties

Compound Name3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylic acid
PubChem CID141284358
Molecular FormulaC8H12F2N2O2
Molecular Weight206.19 g/mol
Exact Mass206.09
IUPAC Name3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylic acid
SMILESO=C(O)N1CC(N2CCC(F)(F)C2)C1
InChIInChI=1S/C8H12F2N2O2/c9-8(10)1-2-11(5-8)6-3-12(4-6)7(13)14/h6H,1-5H2,(H,13,14)
InChIKeyLFJMHABUODYCLT-UHFFFAOYSA-N
XLogP0.69
TPSA43.78 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.19
LogP ≤ 50.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylic acid?
The IUPAC name of 3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylic acid (CID 141284358) is 3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylic acid.
What is the SMILES notation for 3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylic acid?
The canonical SMILES for 3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylic acid is O=C(O)N1CC(N2CCC(F)(F)C2)C1.
What is the InChIKey of 3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylic acid?
The InChIKey is LFJMHABUODYCLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2N2O2/c9-8(10)1-2-11(5-8)6-3-12(4-6)7(13)14/h6H,1-5H2,(H,13,14).
What are the key properties of 3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylic acid?
3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylic acid has a molecular weight of 206.19 g/mol, XLogP of 0.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylic acid is sourced from PubChem (CID 141284358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).