C22H25N5OS — CID 135300375
2-butylsulfanyl-7-(1,3-dimethylpyrazol-4-yl)-5-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidine (PubChem CID 135300375) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is 2-butylsulfanyl-7-(1,3-dimethylpyrazol-4-yl)-5-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidine.
| Compound Name | 2-butylsulfanyl-7-(1,3-dimethylpyrazol-4-yl)-5-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 135300375 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-butylsulfanyl-7-(1,3-dimethylpyrazol-4-yl)-5-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidine |
| SMILES | CCCCSc1cc2nc(-c3ccc(OC)cc3)cc(-c3cn(C)nc3C)n2n1 |
| InChI | InChI=1S/C22H25N5OS/c1-5-6-11-29-22-13-21-23-19(16-7-9-17(28-4)10-8-16)12-20(27(21)25-22)18-14-26(3)24-15(18)2/h7-10,12-14H,5-6,11H2,1-4H3 |
| InChIKey | BMJHCSKWQSMEOJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|