C19H21N3OS — CID 11151957
13-butylsulfanyl-5-methoxy-11,12,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,12,14,16-heptaene (PubChem CID 11151957) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is 13-butylsulfanyl-5-methoxy-11,12,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,12,14,16-heptaene.
| Compound Name | 13-butylsulfanyl-5-methoxy-11,12,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,12,14,16-heptaene |
|---|---|
| PubChem CID | 11151957 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 13-butylsulfanyl-5-methoxy-11,12,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,12,14,16-heptaene |
| SMILES | CCCCSc1ccc2nc3c(n2n1)CCc1cc(OC)ccc1-3 |
| InChI | InChI=1S/C19H21N3OS/c1-3-4-11-24-18-10-9-17-20-19-15-7-6-14(23-2)12-13(15)5-8-16(19)22(17)21-18/h6-7,9-10,12H,3-5,8,11H2,1-2H3 |
| InChIKey | RSAJLIIQBSZNTQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|