C10H20N2 — CID 135302017
2-butyl-1-ethyl-5,6-dihydro-4H-pyrimidine (PubChem CID 135302017) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 2-butyl-1-ethyl-5,6-dihydro-4H-pyrimidine.
| Compound Name | 2-butyl-1-ethyl-5,6-dihydro-4H-pyrimidine |
|---|---|
| PubChem CID | 135302017 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 2-butyl-1-ethyl-5,6-dihydro-4H-pyrimidine |
| SMILES | CCCCC1=NCCCN1CC |
| InChI | InChI=1S/C10H20N2/c1-3-5-7-10-11-8-6-9-12(10)4-2/h3-9H2,1-2H3 |
| InChIKey | NMYKOQGAEFDQBB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |