C22H32ClNO3 — CID 135303688
(4S)-N-[2-chloro-3-methoxy-5-[(2E,4E)-2-methylhepta-2,4-dienyl]phenyl]-4-methoxy-N-methylpentanamide (PubChem CID 135303688) has the molecular formula C22H32ClNO3 and a molecular weight of 393.96 g/mol. Its IUPAC name is (4S)-N-[2-chloro-3-methoxy-5-[(2E,4E)-2-methylhepta-2,4-dienyl]phenyl]-4-methoxy-N-methylpentanamide.
| Compound Name | (4S)-N-[2-chloro-3-methoxy-5-[(2E,4E)-2-methylhepta-2,4-dienyl]phenyl]-4-methoxy-N-methylpentanamide |
|---|---|
| PubChem CID | 135303688 |
| Molecular Formula | C22H32ClNO3 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (4S)-N-[2-chloro-3-methoxy-5-[(2E,4E)-2-methylhepta-2,4-dienyl]phenyl]-4-methoxy-N-methylpentanamide |
| SMILES | CC/C=C/C=C(\C)Cc1cc(OC)c(Cl)c(N(C)C(=O)CC[C@H](C)OC)c1 |
| InChI | InChI=1S/C22H32ClNO3/c1-7-8-9-10-16(2)13-18-14-19(22(23)20(15-18)27-6)24(4)21(25)12-11-17(3)26-5/h8-10,14-15,17H,7,11-13H2,1-6H3/b9-8+,16-10+/t17-/m0/s1 |
| InChIKey | OFLGSCNABHNKJF-CVRNTUOHSA-N |
| XLogP | 5.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|