C27H40ClNO2 — CID 144935208
2-chloro-5-[(2E,4E)-2,7-dimethylnona-2,4-dienyl]-N-[4-[(2S,3S)-2,3-dimethyloxiran-2-yl]but-1-en-2-yl]-3-methoxy-N-methylaniline (PubChem CID 144935208) has the molecular formula C27H40ClNO2 and a molecular weight of 446.08 g/mol. Its IUPAC name is 2-chloro-5-[(2E,4E)-2,7-dimethylnona-2,4-dienyl]-N-[4-[(2S,3S)-2,3-dimethyloxiran-2-yl]but-1-en-2-yl]-3-methoxy-N-methylaniline.
| Compound Name | 2-chloro-5-[(2E,4E)-2,7-dimethylnona-2,4-dienyl]-N-[4-[(2S,3S)-2,3-dimethyloxiran-2-yl]but-1-en-2-yl]-3-methoxy-N-methylaniline |
|---|---|
| PubChem CID | 144935208 |
| Molecular Formula | C27H40ClNO2 |
| Molecular Weight | 446.08 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 2-chloro-5-[(2E,4E)-2,7-dimethylnona-2,4-dienyl]-N-[4-[(2S,3S)-2,3-dimethyloxiran-2-yl]but-1-en-2-yl]-3-methoxy-N-methylaniline |
| SMILES | C=C(CC[C@]1(C)O[C@H]1C)N(C)c1cc(C/C(C)=C/C=C/CC(C)CC)cc(OC)c1Cl |
| InChI | InChI=1S/C27H40ClNO2/c1-9-19(2)12-10-11-13-20(3)16-23-17-24(26(28)25(18-23)30-8)29(7)21(4)14-15-27(6)22(5)31-27/h10-11,13,17-19,22H,4,9,12,14-16H2,1-3,5-8H3/b11-10+,20-13+/t19?,22-,27-/m0/s1 |
| InChIKey | KIKFWIWIGDKXNB-KFTXCQLVSA-N |
| XLogP | 7.74 |
| TPSA | 25.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.08 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|