C31H53ClN2O4 — CID 145224378
(3S)-N-[2-chloro-5-[(2E,4E)-2,7-dimethylnona-2,4-dienyl]-3-methoxyphenyl]-3-(2,3-dimethyloxiran-2-yl)-3-hydroxy-N-methylpropanamide;ethane;N-methylethanamine (PubChem CID 145224378) has the molecular formula C31H53ClN2O4 and a molecular weight of 553.23 g/mol. Its IUPAC name is (3S)-N-[2-chloro-5-[(2E,4E)-2,7-dimethylnona-2,4-dienyl]-3-methoxyphenyl]-3-(2,3-dimethyloxiran-2-yl)-3-hydroxy-N-methylpropanamide;ethane;N-methylethanamine.
| Compound Name | (3S)-N-[2-chloro-5-[(2E,4E)-2,7-dimethylnona-2,4-dienyl]-3-methoxyphenyl]-3-(2,3-dimethyloxiran-2-yl)-3-hydroxy-N-methylpropanamide;ethane;N-methylethanamine |
|---|---|
| PubChem CID | 145224378 |
| Molecular Formula | C31H53ClN2O4 |
| Molecular Weight | 553.23 g/mol |
| Exact Mass | 552.37 |
| IUPAC Name | (3S)-N-[2-chloro-5-[(2E,4E)-2,7-dimethylnona-2,4-dienyl]-3-methoxyphenyl]-3-(2,3-dimethyloxiran-2-yl)-3-hydroxy-N-methylpropanamide;ethane;N-methylethanamine |
| SMILES | CC.CCC(C)C/C=C/C=C(\C)Cc1cc(OC)c(Cl)c(N(C)C(=O)C[C@H](O)C2(C)OC2C)c1.CCNC |
| InChI | InChI=1S/C26H38ClNO4.C3H9N.C2H6/c1-8-17(2)11-9-10-12-18(3)13-20-14-21(25(27)22(15-20)31-7)28(6)24(30)16-23(29)26(5)19(4)32-26;1-3-4-2;1-2/h9-10,12,14-15,17,19,23,29H,8,11,13,16H2,1-7H3;4H,3H2,1-2H3;1-2H3/b10-9+,18-12+;;/t17?,19?,23-,26?;;/m0../s1 |
| InChIKey | VZWSGKLVDDKSDR-FMFOJNHRSA-N |
| XLogP | 6.97 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.23 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|