C24H38ClNO2 — CID 144693483
(3E,5E)-7-[4-chloro-3-(dimethylamino)-5-methoxyphenyl]-6-methylhepta-3,5-dien-2-ol;4-methylhex-1-ene (PubChem CID 144693483) has the molecular formula C24H38ClNO2 and a molecular weight of 408.03 g/mol. Its IUPAC name is (3E,5E)-7-[4-chloro-3-(dimethylamino)-5-methoxyphenyl]-6-methylhepta-3,5-dien-2-ol;4-methylhex-1-ene.
| Compound Name | (3E,5E)-7-[4-chloro-3-(dimethylamino)-5-methoxyphenyl]-6-methylhepta-3,5-dien-2-ol;4-methylhex-1-ene |
|---|---|
| PubChem CID | 144693483 |
| Molecular Formula | C24H38ClNO2 |
| Molecular Weight | 408.03 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | (3E,5E)-7-[4-chloro-3-(dimethylamino)-5-methoxyphenyl]-6-methylhepta-3,5-dien-2-ol;4-methylhex-1-ene |
| SMILES | C=CCC(C)CC.COc1cc(C/C(C)=C/C=C/C(C)O)cc(N(C)C)c1Cl |
| InChI | InChI=1S/C17H24ClNO2.C7H14/c1-12(7-6-8-13(2)20)9-14-10-15(19(3)4)17(18)16(11-14)21-5;1-4-6-7(3)5-2/h6-8,10-11,13,20H,9H2,1-5H3;4,7H,1,5-6H2,2-3H3/b8-6+,12-7+; |
| InChIKey | MFBJXJUVJVDFPA-FSNKCASMSA-N |
| XLogP | 6.45 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.03 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|