C15H14F2N2O3 — CID 135308991
1-[(2,6-difluorophenyl)methyl]-4-[(E)-2-ethoxyethenyl]pyrazole-3-carboxylic acid (PubChem CID 135308991) has the molecular formula C15H14F2N2O3 and a molecular weight of 308.28 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]-4-[(E)-2-ethoxyethenyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[(2,6-difluorophenyl)methyl]-4-[(E)-2-ethoxyethenyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 135308991 |
| Molecular Formula | C15H14F2N2O3 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]-4-[(E)-2-ethoxyethenyl]pyrazole-3-carboxylic acid |
| SMILES | CCO/C=C/c1cn(Cc2c(F)cccc2F)nc1C(=O)O |
| InChI | InChI=1S/C15H14F2N2O3/c1-2-22-7-6-10-8-19(18-14(10)15(20)21)9-11-12(16)4-3-5-13(11)17/h3-8H,2,9H2,1H3,(H,20,21)/b7-6+ |
| InChIKey | UWYGPZPDVIEETP-VOTSOKGWSA-N |
| XLogP | 2.91 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|