About CID 135309275
CID 135309275 (PubChem CID 135309275) has the molecular formula C20H29F3N7O2S-
and a molecular weight of 488.56 g/mol.
Molecular Properties
| Compound Name | CID 135309275 |
| PubChem CID | 135309275 |
| Molecular Formula | C20H29F3N7O2S- |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | — |
| SMILES | NC1CCC(NC2CCC(c3ccc(C(F)(F)F)cc3-c3nn[nH]n3)CC2)CC1.NS(=O)[O-] |
| InChI | InChI=1S/C20H27F3N6.H3NO2S/c21-20(22,23)13-3-10-17(18(11-13)19-26-28-29-27-19)12-1-6-15(7-2-12)25-16-8-4-14(24)5-9-16;1-4(2)3/h3,10-12,14-16,25H,1-2,4-9,24H2,(H,26,27,28,29);1H2,(H,2,3)/p-1 |
| InChIKey | DPEUMTUCSPYYBP-UHFFFAOYSA-M |
| XLogP | 2.51 |
| TPSA | 158.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze CID 135309275 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135309275?
The IUPAC name of CID 135309275 (CID 135309275) is not available.
What is the SMILES notation for CID 135309275?
The canonical SMILES for CID 135309275 is NC1CCC(NC2CCC(c3ccc(C(F)(F)F)cc3-c3nn[nH]n3)CC2)CC1.NS(=O)[O-].
What is the InChIKey of CID 135309275?
The InChIKey is DPEUMTUCSPYYBP-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H27F3N6.H3NO2S/c21-20(22,23)13-3-10-17(18(11-13)19-26-28-29-27-19)12-1-6-15(7-2-12)25-16-8-4-14(24)5-9-16;1-4(2)3/h3,10-12,14-16,25H,1-2,4-9,24H2,(H,26,27,28,29);1H2,(H,2,3)/p-1.
What are the key properties of CID 135309275?
CID 135309275 has a molecular weight of 488.56 g/mol, XLogP of 2.51, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135309275 is sourced from PubChem (CID 135309275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).