C20H29F3N7O2S- — CID 135309275
CID 135309275 (PubChem CID 135309275) has the molecular formula C20H29F3N7O2S- and a molecular weight of 488.56 g/mol.
| Compound Name | CID 135309275 |
|---|---|
| PubChem CID | 135309275 |
| Molecular Formula | C20H29F3N7O2S- |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | — |
| SMILES | NC1CCC(NC2CCC(c3ccc(C(F)(F)F)cc3-c3nn[nH]n3)CC2)CC1.NS(=O)[O-] |
| InChI | InChI=1S/C20H27F3N6.H3NO2S/c21-20(22,23)13-3-10-17(18(11-13)19-26-28-29-27-19)12-1-6-15(7-2-12)25-16-8-4-14(24)5-9-16;1-4(2)3/h3,10-12,14-16,25H,1-2,4-9,24H2,(H,26,27,28,29);1H2,(H,2,3)/p-1 |
| InChIKey | DPEUMTUCSPYYBP-UHFFFAOYSA-M |
| XLogP | 2.51 |
| TPSA | 158.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|