C18H15F4N5O — CID 72736520
5-[2-[(3S)-3-(4-fluorophenoxy)pyrrolidin-1-yl]-5-(trifluoromethyl)phenyl]-2H-tetrazole (PubChem CID 72736520) has the molecular formula C18H15F4N5O and a molecular weight of 393.34 g/mol. Its IUPAC name is 5-[2-[(3S)-3-(4-fluorophenoxy)pyrrolidin-1-yl]-5-(trifluoromethyl)phenyl]-2H-tetrazole.
| Compound Name | 5-[2-[(3S)-3-(4-fluorophenoxy)pyrrolidin-1-yl]-5-(trifluoromethyl)phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 72736520 |
| Molecular Formula | C18H15F4N5O |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 5-[2-[(3S)-3-(4-fluorophenoxy)pyrrolidin-1-yl]-5-(trifluoromethyl)phenyl]-2H-tetrazole |
| SMILES | Fc1ccc(O[C@H]2CCN(c3ccc(C(F)(F)F)cc3-c3nn[nH]n3)C2)cc1 |
| InChI | InChI=1S/C18H15F4N5O/c19-12-2-4-13(5-3-12)28-14-7-8-27(10-14)16-6-1-11(18(20,21)22)9-15(16)17-23-25-26-24-17/h1-6,9,14H,7-8,10H2,(H,23,24,25,26)/t14-/m0/s1 |
| InChIKey | OZOLYNAPOLFWJZ-AWEZNQCLSA-N |
| XLogP | 3.68 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |