C22H23N5O — CID 135309461
1-(4-benzyl-10-phenyl-1,4,7,11,12-pentazatricyclo[7.3.0.02,6]dodeca-9,11-dien-7-yl)ethanone (PubChem CID 135309461) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is 1-(4-benzyl-10-phenyl-1,4,7,11,12-pentazatricyclo[7.3.0.02,6]dodeca-9,11-dien-7-yl)ethanone.
| Compound Name | 1-(4-benzyl-10-phenyl-1,4,7,11,12-pentazatricyclo[7.3.0.02,6]dodeca-9,11-dien-7-yl)ethanone |
|---|---|
| PubChem CID | 135309461 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 1-(4-benzyl-10-phenyl-1,4,7,11,12-pentazatricyclo[7.3.0.02,6]dodeca-9,11-dien-7-yl)ethanone |
| SMILES | CC(=O)N1Cc2c(-c3ccccc3)nnn2C2CN(Cc3ccccc3)CC21 |
| InChI | InChI=1S/C22H23N5O/c1-16(28)26-15-21-22(18-10-6-3-7-11-18)23-24-27(21)20-14-25(13-19(20)26)12-17-8-4-2-5-9-17/h2-11,19-20H,12-15H2,1H3 |
| InChIKey | PRQMSMBTHJBOBR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |