C21H23ClN4 — CID 159018813
(2R,6S)-4-benzyl-10-phenyl-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene;hydrochloride (PubChem CID 159018813) has the molecular formula C21H23ClN4 and a molecular weight of 366.90 g/mol. Its IUPAC name is (2R,6S)-4-benzyl-10-phenyl-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene;hydrochloride.
| Compound Name | (2R,6S)-4-benzyl-10-phenyl-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene;hydrochloride |
|---|---|
| PubChem CID | 159018813 |
| Molecular Formula | C21H23ClN4 |
| Molecular Weight | 366.90 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (2R,6S)-4-benzyl-10-phenyl-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene;hydrochloride |
| SMILES | Cl.c1ccc(CN2C[C@@H]3CCc4c(-c5ccccc5)nnn4[C@H]3C2)cc1 |
| InChI | InChI=1S/C21H22N4.ClH/c1-3-7-16(8-4-1)13-24-14-18-11-12-19-21(17-9-5-2-6-10-17)22-23-25(19)20(18)15-24;/h1-10,18,20H,11-15H2;1H/t18-,20-;/m0./s1 |
| InChIKey | YOIIXPNIBCKGQF-MKSBGGEFSA-N |
| XLogP | 3.99 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.90 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |