C21H21FN4 — CID 147976377
(2S,6R)-4-[(4-fluorophenyl)methyl]-10-phenyl-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene (PubChem CID 147976377) has the molecular formula C21H21FN4 and a molecular weight of 348.42 g/mol. Its IUPAC name is (2S,6R)-4-[(4-fluorophenyl)methyl]-10-phenyl-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene.
| Compound Name | (2S,6R)-4-[(4-fluorophenyl)methyl]-10-phenyl-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
|---|---|
| PubChem CID | 147976377 |
| Molecular Formula | C21H21FN4 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (2S,6R)-4-[(4-fluorophenyl)methyl]-10-phenyl-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
| SMILES | Fc1ccc(CN2C[C@H]3CCc4c(-c5ccccc5)nnn4[C@@H]3C2)cc1 |
| InChI | InChI=1S/C21H21FN4/c22-18-9-6-15(7-10-18)12-25-13-17-8-11-19-21(16-4-2-1-3-5-16)23-24-26(19)20(17)14-25/h1-7,9-10,17,20H,8,11-14H2/t17-,20-/m1/s1 |
| InChIKey | ISIZFWVVLIAYHE-YLJYHZDGSA-N |
| XLogP | 3.70 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |