C20H23N5 — CID 144988295
(2R,6R)-4-benzyl-10-phenyl-1,4,7,11,12-pentazatricyclo[7.3.0.02,6]dodeca-9,11-diene;molecular hydrogen (PubChem CID 144988295) has the molecular formula C20H23N5 and a molecular weight of 333.44 g/mol. Its IUPAC name is (2R,6R)-4-benzyl-10-phenyl-1,4,7,11,12-pentazatricyclo[7.3.0.02,6]dodeca-9,11-diene;molecular hydrogen.
| Compound Name | (2R,6R)-4-benzyl-10-phenyl-1,4,7,11,12-pentazatricyclo[7.3.0.02,6]dodeca-9,11-diene;molecular hydrogen |
|---|---|
| PubChem CID | 144988295 |
| Molecular Formula | C20H23N5 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | (2R,6R)-4-benzyl-10-phenyl-1,4,7,11,12-pentazatricyclo[7.3.0.02,6]dodeca-9,11-diene;molecular hydrogen |
| SMILES | [H][H].c1ccc(CN2C[C@@H]3[C@@H](C2)NCc2c(-c4ccccc4)nnn23)cc1 |
| InChI | InChI=1S/C20H21N5.H2/c1-3-7-15(8-4-1)12-24-13-17-19(14-24)25-18(11-21-17)20(22-23-25)16-9-5-2-6-10-16;/h1-10,17,19,21H,11-14H2;1H/t17-,19-;/m1./s1 |
| InChIKey | BDMUMXOHJXVMKZ-POCMBTLOSA-N |
| XLogP | 2.72 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |