C22H28ClFN4O4S — CID 135316810
N-(3-chloro-4-fluorophenyl)-5-[3-[3-(dimethylamino)propoxy]phenyl]-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 135316810) has the molecular formula C22H28ClFN4O4S and a molecular weight of 499.01 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5-[3-[3-(dimethylamino)propoxy]phenyl]-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5-[3-[3-(dimethylamino)propoxy]phenyl]-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 135316810 |
| Molecular Formula | C22H28ClFN4O4S |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5-[3-[3-(dimethylamino)propoxy]phenyl]-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | CN(C)CCCOc1cccc(C2CC(C(=O)Nc3ccc(F)c(Cl)c3)N(C)S(=O)(=O)N2)c1 |
| InChI | InChI=1S/C22H28ClFN4O4S/c1-27(2)10-5-11-32-17-7-4-6-15(12-17)20-14-21(28(3)33(30,31)26-20)22(29)25-16-8-9-19(24)18(23)13-16/h4,6-9,12-13,20-21,26H,5,10-11,14H2,1-3H3,(H,25,29) |
| InChIKey | PBCWEWXXQHECSJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|