C23H30ClFN4O2S — CID 142419847
N-(3-chloro-4-fluorophenyl)-5-[4-[3-(dimethylamino)propoxy]phenyl]-2-methyl-1-methylidene-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 142419847) has the molecular formula C23H30ClFN4O2S and a molecular weight of 481.04 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5-[4-[3-(dimethylamino)propoxy]phenyl]-2-methyl-1-methylidene-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5-[4-[3-(dimethylamino)propoxy]phenyl]-2-methyl-1-methylidene-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 142419847 |
| Molecular Formula | C23H30ClFN4O2S |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5-[4-[3-(dimethylamino)propoxy]phenyl]-2-methyl-1-methylidene-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | C=S1NC(c2ccc(OCCCN(C)C)cc2)CC(C(=O)Nc2ccc(F)c(Cl)c2)N1C |
| InChI | InChI=1S/C23H30ClFN4O2S/c1-28(2)12-5-13-31-18-9-6-16(7-10-18)21-15-22(29(3)32(4)27-21)23(30)26-17-8-11-20(25)19(24)14-17/h6-11,14,21-22,27H,4-5,12-13,15H2,1-3H3,(H,26,30) |
| InChIKey | PDFUSADKKVSKND-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|