C23H23NO3 — CID 135320561
2-[3-[(3,5-dimethylphenyl)methoxy]phenyl]-N-hydroxy-2-phenylacetamide (PubChem CID 135320561) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-[3-[(3,5-dimethylphenyl)methoxy]phenyl]-N-hydroxy-2-phenylacetamide.
| Compound Name | 2-[3-[(3,5-dimethylphenyl)methoxy]phenyl]-N-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 135320561 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-[3-[(3,5-dimethylphenyl)methoxy]phenyl]-N-hydroxy-2-phenylacetamide |
| SMILES | Cc1cc(C)cc(COc2cccc(C(C(=O)NO)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C23H23NO3/c1-16-11-17(2)13-18(12-16)15-27-21-10-6-9-20(14-21)22(23(25)24-26)19-7-4-3-5-8-19/h3-14,22,26H,15H2,1-2H3,(H,24,25) |
| InChIKey | BWPLJWMSMLWOOF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|