C20H32N2O3 — CID 135320625
3-[4-(4-amino-2-methyl-5-propan-2-yloxyphenyl)piperidin-1-yl]-2,2-dimethylpropanoic acid (PubChem CID 135320625) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is 3-[4-(4-amino-2-methyl-5-propan-2-yloxyphenyl)piperidin-1-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[4-(4-amino-2-methyl-5-propan-2-yloxyphenyl)piperidin-1-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 135320625 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 3-[4-(4-amino-2-methyl-5-propan-2-yloxyphenyl)piperidin-1-yl]-2,2-dimethylpropanoic acid |
| SMILES | Cc1cc(N)c(OC(C)C)cc1C1CCN(CC(C)(C)C(=O)O)CC1 |
| InChI | InChI=1S/C20H32N2O3/c1-13(2)25-18-11-16(14(3)10-17(18)21)15-6-8-22(9-7-15)12-20(4,5)19(23)24/h10-11,13,15H,6-9,12,21H2,1-5H3,(H,23,24) |
| InChIKey | UWZMMBUUFDWTDW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|