C17H28N2O4 — CID 144736293
4-(4-amino-2-methyl-5-propan-2-yloxyphenyl)-2-methoxy-6-methylpiperidine-2,6-diol (PubChem CID 144736293) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is 4-(4-amino-2-methyl-5-propan-2-yloxyphenyl)-2-methoxy-6-methylpiperidine-2,6-diol.
| Compound Name | 4-(4-amino-2-methyl-5-propan-2-yloxyphenyl)-2-methoxy-6-methylpiperidine-2,6-diol |
|---|---|
| PubChem CID | 144736293 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 4-(4-amino-2-methyl-5-propan-2-yloxyphenyl)-2-methoxy-6-methylpiperidine-2,6-diol |
| SMILES | COC1(O)CC(c2cc(OC(C)C)c(N)cc2C)CC(C)(O)N1 |
| InChI | InChI=1S/C17H28N2O4/c1-10(2)23-15-7-13(11(3)6-14(15)18)12-8-16(4,20)19-17(21,9-12)22-5/h6-7,10,12,19-21H,8-9,18H2,1-5H3 |
| InChIKey | OIFXDLAWXLOLED-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|