C15H12F2N4O — CID 135321208
2-[[1-(2,4-difluorophenyl)-2-ethenoxyethyl]amino]pyrimidine-5-carbonitrile (PubChem CID 135321208) has the molecular formula C15H12F2N4O and a molecular weight of 302.28 g/mol. Its IUPAC name is 2-[[1-(2,4-difluorophenyl)-2-ethenoxyethyl]amino]pyrimidine-5-carbonitrile.
| Compound Name | 2-[[1-(2,4-difluorophenyl)-2-ethenoxyethyl]amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 135321208 |
| Molecular Formula | C15H12F2N4O |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-[[1-(2,4-difluorophenyl)-2-ethenoxyethyl]amino]pyrimidine-5-carbonitrile |
| SMILES | C=COCC(Nc1ncc(C#N)cn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H12F2N4O/c1-2-22-9-14(12-4-3-11(16)5-13(12)17)21-15-19-7-10(6-18)8-20-15/h2-5,7-8,14H,1,9H2,(H,19,20,21) |
| InChIKey | MFWJYWRTSCNZKD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|