C27H18F6N2O2S — CID 135325077
(1S)-1-[2-(2,4-difluorophenyl)-4-(trifluoromethyl)phenyl]-N-(6-fluoro-2-pyridinyl)-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 135325077) has the molecular formula C27H18F6N2O2S and a molecular weight of 548.51 g/mol. Its IUPAC name is (1S)-1-[2-(2,4-difluorophenyl)-4-(trifluoromethyl)phenyl]-N-(6-fluoro-2-pyridinyl)-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | (1S)-1-[2-(2,4-difluorophenyl)-4-(trifluoromethyl)phenyl]-N-(6-fluoro-2-pyridinyl)-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 135325077 |
| Molecular Formula | C27H18F6N2O2S |
| Molecular Weight | 548.51 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | (1S)-1-[2-(2,4-difluorophenyl)-4-(trifluoromethyl)phenyl]-N-(6-fluoro-2-pyridinyl)-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(F)n1)c1ccc2c(c1)CC[C@@H]2c1ccc(C(F)(F)F)cc1-c1ccc(F)cc1F |
| InChI | InChI=1S/C27H18F6N2O2S/c28-17-6-10-22(24(29)14-17)23-13-16(27(31,32)33)5-9-21(23)20-8-4-15-12-18(7-11-19(15)20)38(36,37)35-26-3-1-2-25(30)34-26/h1-3,5-7,9-14,20H,4,8H2,(H,34,35)/t20-/m0/s1 |
| InChIKey | YIEIUTKPULKBSZ-FQEVSTJZSA-N |
| XLogP | 7.06 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.51 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|