C28H22F4N2O3S — CID 154031718
N-(6-fluoro-2-pyridinyl)-1-[2-(4-methoxyphenyl)-4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 154031718) has the molecular formula C28H22F4N2O3S and a molecular weight of 542.55 g/mol. Its IUPAC name is N-(6-fluoro-2-pyridinyl)-1-[2-(4-methoxyphenyl)-4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-(6-fluoro-2-pyridinyl)-1-[2-(4-methoxyphenyl)-4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 154031718 |
| Molecular Formula | C28H22F4N2O3S |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | N-(6-fluoro-2-pyridinyl)-1-[2-(4-methoxyphenyl)-4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)ccc2C2CCc3cc(S(=O)(=O)Nc4cccc(F)n4)ccc32)cc1 |
| InChI | InChI=1S/C28H22F4N2O3S/c1-37-20-9-5-17(6-10-20)25-16-19(28(30,31)32)8-13-24(25)23-12-7-18-15-21(11-14-22(18)23)38(35,36)34-27-4-2-3-26(29)33-27/h2-6,8-11,13-16,23H,7,12H2,1H3,(H,33,34) |
| InChIKey | LQRAMOCIHBKHMF-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|