C25H13F8NO4S — CID 135331488
(2,3,4,5,6-pentafluorophenyl) 1-[2-(1,3-oxazol-2-yl)-4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene-5-sulfonate (PubChem CID 135331488) has the molecular formula C25H13F8NO4S and a molecular weight of 575.43 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 1-[2-(1,3-oxazol-2-yl)-4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene-5-sulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 1-[2-(1,3-oxazol-2-yl)-4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene-5-sulfonate |
|---|---|
| PubChem CID | 135331488 |
| Molecular Formula | C25H13F8NO4S |
| Molecular Weight | 575.43 g/mol |
| Exact Mass | 575.04 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 1-[2-(1,3-oxazol-2-yl)-4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene-5-sulfonate |
| SMILES | O=S(=O)(Oc1c(F)c(F)c(F)c(F)c1F)c1ccc2c(c1)CCC2c1ccc(C(F)(F)F)cc1-c1ncco1 |
| InChI | InChI=1S/C25H13F8NO4S/c26-18-19(27)21(29)23(22(30)20(18)28)38-39(35,36)13-3-6-14-11(9-13)1-4-15(14)16-5-2-12(25(31,32)33)10-17(16)24-34-7-8-37-24/h2-3,5-10,15H,1,4H2 |
| InChIKey | AYHJNHISAUKYLY-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.43 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|