C16H17F3N4O — CID 135331999
5-[2-(piperazin-1-ylmethyl)-5-(trifluoromethyl)phenoxy]pyrimidine (PubChem CID 135331999) has the molecular formula C16H17F3N4O and a molecular weight of 338.33 g/mol. Its IUPAC name is 5-[2-(piperazin-1-ylmethyl)-5-(trifluoromethyl)phenoxy]pyrimidine.
| Compound Name | 5-[2-(piperazin-1-ylmethyl)-5-(trifluoromethyl)phenoxy]pyrimidine |
|---|---|
| PubChem CID | 135331999 |
| Molecular Formula | C16H17F3N4O |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 5-[2-(piperazin-1-ylmethyl)-5-(trifluoromethyl)phenoxy]pyrimidine |
| SMILES | FC(F)(F)c1ccc(CN2CCNCC2)c(Oc2cncnc2)c1 |
| InChI | InChI=1S/C16H17F3N4O/c17-16(18,19)13-2-1-12(10-23-5-3-20-4-6-23)15(7-13)24-14-8-21-11-22-9-14/h1-2,7-9,11,20H,3-6,10H2 |
| InChIKey | MSXHJXGVJCKAKN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |