C14H20N2O3S — CID 135336331
4-piperidin-1-yl-3,4-dihydro-2H-chromene-7-sulfonamide (PubChem CID 135336331) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is 4-piperidin-1-yl-3,4-dihydro-2H-chromene-7-sulfonamide.
| Compound Name | 4-piperidin-1-yl-3,4-dihydro-2H-chromene-7-sulfonamide |
|---|---|
| PubChem CID | 135336331 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-piperidin-1-yl-3,4-dihydro-2H-chromene-7-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)OCCC2N1CCCCC1 |
| InChI | InChI=1S/C14H20N2O3S/c15-20(17,18)11-4-5-12-13(6-9-19-14(12)10-11)16-7-2-1-3-8-16/h4-5,10,13H,1-3,6-9H2,(H2,15,17,18) |
| InChIKey | IUGSBKGSNUUVSM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |