C14H19N6O7P — CID 135336754
(2S)-2-[[(5S)-5-[(6-aminopurin-9-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]amino]pentanedioic acid (PubChem CID 135336754) has the molecular formula C14H19N6O7P and a molecular weight of 414.32 g/mol. Its IUPAC name is (2S)-2-[[(5S)-5-[(6-aminopurin-9-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(5S)-5-[(6-aminopurin-9-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 135336754 |
| Molecular Formula | C14H19N6O7P |
| Molecular Weight | 414.32 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | (2S)-2-[[(5S)-5-[(6-aminopurin-9-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]amino]pentanedioic acid |
| SMILES | Nc1ncnc2c1ncn2C[C@H]1COP(=O)(N[C@@H](CCC(=O)O)C(=O)O)CO1 |
| InChI | InChI=1S/C14H19N6O7P/c15-12-11-13(17-5-16-12)20(6-18-11)3-8-4-27-28(25,7-26-8)19-9(14(23)24)1-2-10(21)22/h5-6,8-9H,1-4,7H2,(H,19,25)(H,21,22)(H,23,24)(H2,15,16,17)/t8-,9-,28?/m0/s1 |
| InChIKey | GCBNTGRAHKVAOZ-VEGRMHPFSA-N |
| XLogP | -0.12 |
| TPSA | 191.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.32 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|