C20H33N8O7P — CID 52945320
propan-2-yl (2R)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-[[(2R,5S)-5-[(2,6-diaminopurin-9-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]oxy]propanoate (PubChem CID 52945320) has the molecular formula C20H33N8O7P and a molecular weight of 528.51 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-[[(2R,5S)-5-[(2,6-diaminopurin-9-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]oxy]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-[[(2R,5S)-5-[(2,6-diaminopurin-9-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]oxy]propanoate |
|---|---|
| PubChem CID | 52945320 |
| Molecular Formula | C20H33N8O7P |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | propan-2-yl (2R)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-[[(2R,5S)-5-[(2,6-diaminopurin-9-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]oxy]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](CO[P@]1(=O)CO[C@@H](Cn2cnc3c(N)nc(N)nc32)CO1)NC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C20H33N8O7P/c1-10(2)14(21)18(29)25-13(19(30)35-11(3)4)7-34-36(31)9-32-12(6-33-36)5-28-8-24-15-16(22)26-20(23)27-17(15)28/h8,10-14H,5-7,9,21H2,1-4H3,(H,25,29)(H4,22,23,26,27)/t12-,13+,14-,36-/m0/s1 |
| InChIKey | DUNXKVFMHGQXKD-NGWTYAELSA-N |
| XLogP | -0.01 |
| TPSA | 221.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|