C14H21N6O5PS — CID 135336950
2-[[(5S)-5-[(6-aminopurin-9-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 135336950) has the molecular formula C14H21N6O5PS and a molecular weight of 416.40 g/mol. Its IUPAC name is 2-[[(5S)-5-[(6-aminopurin-9-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[(5S)-5-[(6-aminopurin-9-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 135336950 |
| Molecular Formula | C14H21N6O5PS |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 2-[[(5S)-5-[(6-aminopurin-9-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NP1(=O)CO[C@@H](Cn2cnc3c(N)ncnc32)CO1)C(=O)O |
| InChI | InChI=1S/C14H21N6O5PS/c1-27-3-2-10(14(21)22)19-26(23)8-24-9(5-25-26)4-20-7-18-11-12(15)16-6-17-13(11)20/h6-7,9-10H,2-5,8H2,1H3,(H,19,23)(H,21,22)(H2,15,16,17)/t9-,10?,26?/m0/s1 |
| InChIKey | OKHVJGXSEYXEIV-QXYFFFJKSA-N |
| XLogP | 0.77 |
| TPSA | 154.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|