C12H18N6O5P+ — CID 135336819
(2S)-2-[[(5S)-5-[(6-aminopurin-9-yl)methyl]-2-hydroxy-1,4,2-dioxaphosphinan-2-ium-2-yl]amino]propanoic acid (PubChem CID 135336819) has the molecular formula C12H18N6O5P+ and a molecular weight of 357.29 g/mol. Its IUPAC name is (2S)-2-[[(5S)-5-[(6-aminopurin-9-yl)methyl]-2-hydroxy-1,4,2-dioxaphosphinan-2-ium-2-yl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(5S)-5-[(6-aminopurin-9-yl)methyl]-2-hydroxy-1,4,2-dioxaphosphinan-2-ium-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 135336819 |
| Molecular Formula | C12H18N6O5P+ |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | (2S)-2-[[(5S)-5-[(6-aminopurin-9-yl)methyl]-2-hydroxy-1,4,2-dioxaphosphinan-2-ium-2-yl]amino]propanoic acid |
| SMILES | C[C@H](N[P+]1(O)CO[C@@H](Cn2cnc3c(N)ncnc32)CO1)C(=O)O |
| InChI | InChI=1S/C12H17N6O5P/c1-7(12(19)20)17-24(21)6-22-8(3-23-24)2-18-5-16-9-10(13)14-4-15-11(9)18/h4-5,7-8,17,21H,2-3,6H2,1H3,(H2-,13,14,15,19,20)/p+1/t7-,8-,24?/m0/s1 |
| InChIKey | FEVHLSSTQNSWEX-DDVOIYQLSA-O |
| XLogP | -0.40 |
| TPSA | 157.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|