C9H10N5O5P — CID 10542134
6-[(6-aminopurin-9-yl)methyl]-2-hydroxy-2-oxo-1,4,2λ5-dioxaphosphinan-3-one (PubChem CID 10542134) has the molecular formula C9H10N5O5P and a molecular weight of 299.18 g/mol. Its IUPAC name is 6-[(6-aminopurin-9-yl)methyl]-2-hydroxy-2-oxo-1,4,2λ5-dioxaphosphinan-3-one.
| Compound Name | 6-[(6-aminopurin-9-yl)methyl]-2-hydroxy-2-oxo-1,4,2λ5-dioxaphosphinan-3-one |
|---|---|
| PubChem CID | 10542134 |
| Molecular Formula | C9H10N5O5P |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 6-[(6-aminopurin-9-yl)methyl]-2-hydroxy-2-oxo-1,4,2λ5-dioxaphosphinan-3-one |
| SMILES | Nc1ncnc2c1ncn2CC1COC(=O)P(=O)(O)O1 |
| InChI | InChI=1S/C9H10N5O5P/c10-7-6-8(12-3-11-7)14(4-13-6)1-5-2-18-9(15)20(16,17)19-5/h3-5H,1-2H2,(H,16,17)(H2,10,11,12) |
| InChIKey | SCOSKZRERNJVHH-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 142.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|