C14H13N5OS — CID 54769108
9-(2,3-dihydro-1,4-benzoxathiin-2-ylmethyl)purin-6-amine (PubChem CID 54769108) has the molecular formula C14H13N5OS and a molecular weight of 299.36 g/mol. Its IUPAC name is 9-(2,3-dihydro-1,4-benzoxathiin-2-ylmethyl)purin-6-amine.
| Compound Name | 9-(2,3-dihydro-1,4-benzoxathiin-2-ylmethyl)purin-6-amine |
|---|---|
| PubChem CID | 54769108 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 9-(2,3-dihydro-1,4-benzoxathiin-2-ylmethyl)purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2CC1CSc2ccccc2O1 |
| InChI | InChI=1S/C14H13N5OS/c15-13-12-14(17-7-16-13)19(8-18-12)5-9-6-21-11-4-2-1-3-10(11)20-9/h1-4,7-9H,5-6H2,(H2,15,16,17) |
| InChIKey | VXYMAODNRFWVRY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |