C12H18N4O3 — CID 135337374
[1-(methylcarbamoyl)piperidin-4-yl]methyl imidazole-1-carboxylate (PubChem CID 135337374) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is [1-(methylcarbamoyl)piperidin-4-yl]methyl imidazole-1-carboxylate.
| Compound Name | [1-(methylcarbamoyl)piperidin-4-yl]methyl imidazole-1-carboxylate |
|---|---|
| PubChem CID | 135337374 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | [1-(methylcarbamoyl)piperidin-4-yl]methyl imidazole-1-carboxylate |
| SMILES | CNC(=O)N1CCC(COC(=O)n2ccnc2)CC1 |
| InChI | InChI=1S/C12H18N4O3/c1-13-11(17)15-5-2-10(3-6-15)8-19-12(18)16-7-4-14-9-16/h4,7,9-10H,2-3,5-6,8H2,1H3,(H,13,17) |
| InChIKey | WFAVFZYLRVIGCC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |