About [1-(2-acetyloxyacetyl)piperidin-4-yl]methyl imidazole-1-carboxylate
[1-(2-acetyloxyacetyl)piperidin-4-yl]methyl imidazole-1-carboxylate (PubChem CID 153315357) has the molecular formula C14H19N3O5
and a molecular weight of 309.32 g/mol. Its IUPAC name is [1-(2-acetyloxyacetyl)piperidin-4-yl]methyl imidazole-1-carboxylate.
Molecular Properties
| Compound Name | [1-(2-acetyloxyacetyl)piperidin-4-yl]methyl imidazole-1-carboxylate |
| PubChem CID | 153315357 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | [1-(2-acetyloxyacetyl)piperidin-4-yl]methyl imidazole-1-carboxylate |
| SMILES | CC(=O)OCC(=O)N1CCC(COC(=O)n2ccnc2)CC1 |
| InChI | InChI=1S/C14H19N3O5/c1-11(18)21-9-13(19)16-5-2-12(3-6-16)8-22-14(20)17-7-4-15-10-17/h4,7,10,12H,2-3,5-6,8-9H2,1H3 |
| InChIKey | LDZFVOBGNAZWCG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-(2-acetyloxyacetyl)piperidin-4-yl]methyl imidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-acetyloxyacetyl)piperidin-4-yl]methyl imidazole-1-carboxylate?
The IUPAC name of [1-(2-acetyloxyacetyl)piperidin-4-yl]methyl imidazole-1-carboxylate (CID 153315357) is [1-(2-acetyloxyacetyl)piperidin-4-yl]methyl imidazole-1-carboxylate.
What is the SMILES notation for [1-(2-acetyloxyacetyl)piperidin-4-yl]methyl imidazole-1-carboxylate?
The canonical SMILES for [1-(2-acetyloxyacetyl)piperidin-4-yl]methyl imidazole-1-carboxylate is CC(=O)OCC(=O)N1CCC(COC(=O)n2ccnc2)CC1.
What is the InChIKey of [1-(2-acetyloxyacetyl)piperidin-4-yl]methyl imidazole-1-carboxylate?
The InChIKey is LDZFVOBGNAZWCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O5/c1-11(18)21-9-13(19)16-5-2-12(3-6-16)8-22-14(20)17-7-4-15-10-17/h4,7,10,12H,2-3,5-6,8-9H2,1H3.
What are the key properties of [1-(2-acetyloxyacetyl)piperidin-4-yl]methyl imidazole-1-carboxylate?
[1-(2-acetyloxyacetyl)piperidin-4-yl]methyl imidazole-1-carboxylate has a molecular weight of 309.32 g/mol, XLogP of 0.67, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-acetyloxyacetyl)piperidin-4-yl]methyl imidazole-1-carboxylate is sourced from PubChem (CID 153315357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).